C24H34IN3O2 — CID 91063939
(8R,9S,10R,13S,14S,17S)-17-hydroxy-2-[2-(1H-imidazol-5-yl)ethylamino]-2-iodo-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91063939) has the molecular formula C24H34IN3O2 and a molecular weight of 523.46 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-17-hydroxy-2-[2-(1H-imidazol-5-yl)ethylamino]-2-iodo-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-2-[2-(1H-imidazol-5-yl)ethylamino]-2-iodo-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91063939 |
| Molecular Formula | C24H34IN3O2 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-2-[2-(1H-imidazol-5-yl)ethylamino]-2-iodo-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)C(I)(NCCc5cnc[nH]5)C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C24H34IN3O2/c1-22-9-7-19-17(18(22)5-6-20(22)29)4-3-15-11-21(30)24(25,13-23(15,19)2)28-10-8-16-12-26-14-27-16/h11-12,14,17-20,28-29H,3-10,13H2,1-2H3,(H,26,27)/t17-,18-,19-,20-,22-,23-,24?/m0/s1 |
| InChIKey | DKAFPTHCGQSXLO-JOVJPXNQSA-N |
| XLogP | 4.18 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|