C28H40N4O5 — CID 135638945
methyl 2-[[2-[(E)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 135638945) has the molecular formula C28H40N4O5 and a molecular weight of 512.65 g/mol. Its IUPAC name is methyl 2-[[2-[(E)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl 2-[[2-[(E)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 135638945 |
| Molecular Formula | C28H40N4O5 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | methyl 2-[[2-[(E)-[(10R,13S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | COC(=O)C(Cc1cnc[nH]1)NC(=O)CO/N=C1/C=C2CCC3C4CCC(O)[C@@]4(C)CCC3[C@@]2(C)CC1 |
| InChI | InChI=1S/C28H40N4O5/c1-27-10-8-18(32-37-15-25(34)31-23(26(35)36-3)13-19-14-29-16-30-19)12-17(27)4-5-20-21-6-7-24(33)28(21,2)11-9-22(20)27/h12,14,16,20-24,33H,4-11,13,15H2,1-3H3,(H,29,30)(H,31,34)/b32-18+/t20?,21?,22?,23?,24?,27-,28-/m0/s1 |
| InChIKey | PJPCYEHVXAIXOO-ZSEQXYJESA-N |
| XLogP | 3.31 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|