C11H15FO6S — CID 91064451
[(3S,4R,5S)-2-acetyloxy-5-(acetylsulfanylmethyl)-4-fluorooxolan-3-yl] acetate (PubChem CID 91064451) has the molecular formula C11H15FO6S and a molecular weight of 294.30 g/mol. Its IUPAC name is [(3S,4R,5S)-2-acetyloxy-5-(acetylsulfanylmethyl)-4-fluorooxolan-3-yl] acetate.
| Compound Name | [(3S,4R,5S)-2-acetyloxy-5-(acetylsulfanylmethyl)-4-fluorooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 91064451 |
| Molecular Formula | C11H15FO6S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [(3S,4R,5S)-2-acetyloxy-5-(acetylsulfanylmethyl)-4-fluorooxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CSC(C)=O)[C@H](F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H15FO6S/c1-5(13)16-10-9(12)8(4-19-7(3)15)18-11(10)17-6(2)14/h8-11H,4H2,1-3H3/t8-,9+,10-,11?/m1/s1 |
| InChIKey | ONZYAWREFDIYPC-GZBOUJLJSA-N |
| XLogP | 0.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|