C11H15FO7S — CID 141485978
[(2R,3S,4S)-5-acetyloxy-4-fluoro-3-methoxycarbonyloxythiolan-2-yl]methyl acetate (PubChem CID 141485978) has the molecular formula C11H15FO7S and a molecular weight of 310.30 g/mol. Its IUPAC name is [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-methoxycarbonyloxythiolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-methoxycarbonyloxythiolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 141485978 |
| Molecular Formula | C11H15FO7S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-methoxycarbonyloxythiolan-2-yl]methyl acetate |
| SMILES | COC(=O)O[C@H]1[C@H](F)C(OC(C)=O)S[C@@H]1COC(C)=O |
| InChI | InChI=1S/C11H15FO7S/c1-5(13)17-4-7-9(19-11(15)16-3)8(12)10(20-7)18-6(2)14/h7-10H,4H2,1-3H3/t7-,8+,9-,10?/m1/s1 |
| InChIKey | JSRVEECHXUROCE-WSSOQDAQSA-N |
| XLogP | 1.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|