C13H22ClN — CID 91064912
8-chloro-5-ethyl-2,6,7-trimethylocta-5,7-dien-3-imine (PubChem CID 91064912) has the molecular formula C13H22ClN and a molecular weight of 227.78 g/mol. Its IUPAC name is 8-chloro-5-ethyl-2,6,7-trimethylocta-5,7-dien-3-imine.
| Compound Name | 8-chloro-5-ethyl-2,6,7-trimethylocta-5,7-dien-3-imine |
|---|---|
| PubChem CID | 91064912 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.78 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 8-chloro-5-ethyl-2,6,7-trimethylocta-5,7-dien-3-imine |
| SMILES | [H]/N=C(/CC(CC)=C(C)C(C)=CCl)C(C)C |
| InChI | InChI=1S/C13H22ClN/c1-6-12(7-13(15)9(2)3)11(5)10(4)8-14/h8-9,15H,6-7H2,1-5H3/b10-8?,12-11?,15-13- |
| InChIKey | RTJPOGFMSAODIS-AKMGKZMDSA-N |
| XLogP | 4.92 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.78 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|