C11H20ClN — CID 123632512
3-(1-chloroethyl)-5,6-dimethylhept-2-en-4-imine (PubChem CID 123632512) has the molecular formula C11H20ClN and a molecular weight of 201.74 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5,6-dimethylhept-2-en-4-imine.
| Compound Name | 3-(1-chloroethyl)-5,6-dimethylhept-2-en-4-imine |
|---|---|
| PubChem CID | 123632512 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-(1-chloroethyl)-5,6-dimethylhept-2-en-4-imine |
| SMILES | [H]/N=C(/C(=CC)C(C)Cl)C(C)C(C)C |
| InChI | InChI=1S/C11H20ClN/c1-6-10(9(5)12)11(13)8(4)7(2)3/h6-9,13H,1-5H3/b10-6?,13-11+ |
| InChIKey | DTXPHYFAYQRXIH-SVZZHZKYSA-N |
| XLogP | 3.87 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|