C29H39NO5 — CID 91065967
6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[1-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one (PubChem CID 91065967) has the molecular formula C29H39NO5 and a molecular weight of 481.63 g/mol. Its IUPAC name is 6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[1-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one.
| Compound Name | 6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[1-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 91065967 |
| Molecular Formula | C29H39NO5 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[1-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
| SMILES | CC(c1ccc(C2OC(C)(C)C(C)(C)O2)cc1)N1CCC(CC(C)(C)O)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C29H39NO5/c1-20(21-13-15-22(16-14-21)24-33-27(4,5)28(6,7)34-24)30-18-17-29(35-25(30)31,19-26(2,3)32)23-11-9-8-10-12-23/h8-16,20,24,32H,17-19H2,1-7H3 |
| InChIKey | XYGGDPDEUVZSNX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |