C28H38BNO5 — CID 66600626
6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one (PubChem CID 66600626) has the molecular formula C28H38BNO5 and a molecular weight of 479.43 g/mol. Its IUPAC name is 6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one.
| Compound Name | 6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 66600626 |
| Molecular Formula | C28H38BNO5 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 6-(2-hydroxy-2-methylpropyl)-6-phenyl-3-[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-1,3-oxazinan-2-one |
| SMILES | C[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)N1CCC(CC(C)(C)O)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C28H38BNO5/c1-20(21-13-15-23(16-14-21)29-34-26(4,5)27(6,7)35-29)30-18-17-28(33-24(30)31,19-25(2,3)32)22-11-9-8-10-12-22/h8-16,20,32H,17-19H2,1-7H3/t20-,28?/m0/s1 |
| InChIKey | BXQWRZYOOZPLBJ-CQHAJPFMSA-N |
| XLogP | 4.95 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|