C49H40N6 — CID 91067167
2-[bis(1-methyl-4,5-diphenylimidazol-2-yl)methyl]-1-methyl-4,5-diphenylimidazole (PubChem CID 91067167) has the molecular formula C49H40N6 and a molecular weight of 712.90 g/mol. Its IUPAC name is 2-[bis(1-methyl-4,5-diphenylimidazol-2-yl)methyl]-1-methyl-4,5-diphenylimidazole.
| Compound Name | 2-[bis(1-methyl-4,5-diphenylimidazol-2-yl)methyl]-1-methyl-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 91067167 |
| Molecular Formula | C49H40N6 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.33 |
| IUPAC Name | 2-[bis(1-methyl-4,5-diphenylimidazol-2-yl)methyl]-1-methyl-4,5-diphenylimidazole |
| SMILES | Cn1c(C(c2nc(-c3ccccc3)c(-c3ccccc3)n2C)c2nc(-c3ccccc3)c(-c3ccccc3)n2C)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C49H40N6/c1-53-44(37-28-16-7-17-29-37)41(34-22-10-4-11-23-34)50-47(53)40(48-51-42(35-24-12-5-13-25-35)45(54(48)2)38-30-18-8-19-31-38)49-52-43(36-26-14-6-15-27-36)46(55(49)3)39-32-20-9-21-33-39/h4-33,40H,1-3H3 |
| InChIKey | BNXIOQQGEQBYRH-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |