C14H14F2 — CID 91067867
1-(2,2-difluoroethenyl)naphthalene;ethane (PubChem CID 91067867) has the molecular formula C14H14F2 and a molecular weight of 220.26 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)naphthalene;ethane.
| Compound Name | 1-(2,2-difluoroethenyl)naphthalene;ethane |
|---|---|
| PubChem CID | 91067867 |
| Molecular Formula | C14H14F2 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-(2,2-difluoroethenyl)naphthalene;ethane |
| SMILES | CC.FC(F)=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H8F2.C2H6/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;1-2/h1-8H;1-2H3 |
| InChIKey | QXXMLLKQEVDYNZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |