About 1-(2,2-dibromoethenyl)naphthalene
1-(2,2-dibromoethenyl)naphthalene (PubChem CID 12642645) has the molecular formula C12H8Br2
and a molecular weight of 312.00 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)naphthalene.
Molecular Properties
| Compound Name | 1-(2,2-dibromoethenyl)naphthalene |
| PubChem CID | 12642645 |
| Molecular Formula | C12H8Br2 |
| Molecular Weight | 312.00 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 1-(2,2-dibromoethenyl)naphthalene |
| SMILES | BrC(Br)=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H8Br2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H |
| InChIKey | TYXGMECQXLWMSS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.00 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,2-dibromoethenyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dibromoethenyl)naphthalene?
The IUPAC name of 1-(2,2-dibromoethenyl)naphthalene (CID 12642645) is 1-(2,2-dibromoethenyl)naphthalene.
What is the SMILES notation for 1-(2,2-dibromoethenyl)naphthalene?
The canonical SMILES for 1-(2,2-dibromoethenyl)naphthalene is BrC(Br)=Cc1cccc2ccccc12.
What is the InChIKey of 1-(2,2-dibromoethenyl)naphthalene?
The InChIKey is TYXGMECQXLWMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H.
What are the key properties of 1-(2,2-dibromoethenyl)naphthalene?
1-(2,2-dibromoethenyl)naphthalene has a molecular weight of 312.00 g/mol, XLogP of 4.93, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dibromoethenyl)naphthalene is sourced from PubChem (CID 12642645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).