C12H8Br2O — CID 25096638
1-(2,2-dibromoethenyl)naphthalen-2-ol (PubChem CID 25096638) has the molecular formula C12H8Br2O and a molecular weight of 328.00 g/mol. Its IUPAC name is 1-(2,2-dibromoethenyl)naphthalen-2-ol.
| Compound Name | 1-(2,2-dibromoethenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 25096638 |
| Molecular Formula | C12H8Br2O |
| Molecular Weight | 328.00 g/mol |
| Exact Mass | 325.89 |
| IUPAC Name | 1-(2,2-dibromoethenyl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C=C(Br)Br |
| InChI | InChI=1S/C12H8Br2O/c13-12(14)7-10-9-4-2-1-3-8(9)5-6-11(10)15/h1-7,15H |
| InChIKey | MEXOXAPBPRXNFI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |