C18H14O3 — CID 44516242
5-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]benzene-1,3-diol (PubChem CID 44516242) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 44516242 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(/C=C/c2c(O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C18H14O3/c19-14-9-12(10-15(20)11-14)5-7-17-16-4-2-1-3-13(16)6-8-18(17)21/h1-11,19-21H/b7-5+ |
| InChIKey | ZKEUDGUIBVYHBZ-FNORWQNLSA-N |
| XLogP | 4.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|