C23H22NO6S+ — CID 5474363
2-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]-1-methylquinolin-1-ium-8-ol;methyl hydrogen sulfate (PubChem CID 5474363) has the molecular formula C23H22NO6S+ and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]-1-methylquinolin-1-ium-8-ol;methyl hydrogen sulfate.
| Compound Name | 2-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]-1-methylquinolin-1-ium-8-ol;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 5474363 |
| Molecular Formula | C23H22NO6S+ |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[(E)-2-(2-hydroxynaphthalen-1-yl)ethenyl]-1-methylquinolin-1-ium-8-ol;methyl hydrogen sulfate |
| SMILES | COS(=O)(=O)O.C[n+]1c(/C=C/c2c(O)ccc3ccccc23)ccc2cccc(O)c21 |
| InChI | InChI=1S/C22H17NO2.CH4O4S/c1-23-17(11-9-16-6-4-8-21(25)22(16)23)12-13-19-18-7-3-2-5-15(18)10-14-20(19)24;1-5-6(2,3)4/h2-14,25H,1H3;1H3,(H,2,3,4)/p+1 |
| InChIKey | JCPQWSVRPOFZNJ-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|