C23H23N2O6S+ — CID 135573480
7-[(E)-2-(8-hydroxy-1-methylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol;methyl hydrogen sulfate (PubChem CID 135573480) has the molecular formula C23H23N2O6S+ and a molecular weight of 455.51 g/mol. Its IUPAC name is 7-[(E)-2-(8-hydroxy-1-methylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol;methyl hydrogen sulfate.
| Compound Name | 7-[(E)-2-(8-hydroxy-1-methylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 135573480 |
| Molecular Formula | C23H23N2O6S+ |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 7-[(E)-2-(8-hydroxy-1-methylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol;methyl hydrogen sulfate |
| SMILES | COS(=O)(=O)O.Cc1cc(/C=C/c2ccc3cccc(O)c3[n+]2C)c(O)c2ncccc12 |
| InChI | InChI=1S/C22H18N2O2.CH4O4S/c1-14-13-16(22(26)20-18(14)6-4-12-23-20)9-11-17-10-8-15-5-3-7-19(25)21(15)24(17)2;1-5-6(2,3)4/h3-13,25H,1-2H3;1H3,(H,2,3,4)/p+1 |
| InChIKey | LKTPAQRLZVDDHV-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|