C23H21IN2O — CID 135801356
7-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol iodide (PubChem CID 135801356) has the molecular formula C23H21IN2O and a molecular weight of 468.34 g/mol. Its IUPAC name is 7-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol iodide.
| Compound Name | 7-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol iodide |
|---|---|
| PubChem CID | 135801356 |
| Molecular Formula | C23H21IN2O |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 7-[(E)-2-(1,6-dimethylquinolin-1-ium-2-yl)ethenyl]-5-methylquinolin-8-ol iodide |
| SMILES | Cc1ccc2c(ccc(/C=C/c3cc(C)c4cccnc4c3O)[n+]2C)c1.[I-] |
| InChI | InChI=1S/C23H20N2O.HI/c1-15-6-11-21-17(13-15)7-9-19(25(21)3)10-8-18-14-16(2)20-5-4-12-24-22(20)23(18)26;/h4-14H,1-3H3;1H |
| InChIKey | MICXGHNXBHRCKJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 37.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|