C25H25ClN2 — CID 169424186
2-[(E)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1,6-dimethylquinolin-1-ium chloride (PubChem CID 169424186) has the molecular formula C25H25ClN2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-[(E)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1,6-dimethylquinolin-1-ium chloride.
| Compound Name | 2-[(E)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1,6-dimethylquinolin-1-ium chloride |
|---|---|
| PubChem CID | 169424186 |
| Molecular Formula | C25H25ClN2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[(E)-2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1,6-dimethylquinolin-1-ium chloride |
| SMILES | Cc1ccc2c(ccc(/C=C/c3cc(C)n(-c4ccccc4)c3C)[n+]2C)c1.[Cl-] |
| InChI | InChI=1S/C25H25N2.ClH/c1-18-10-15-25-22(16-18)12-14-23(26(25)4)13-11-21-17-19(2)27(20(21)3)24-8-6-5-7-9-24;/h5-17H,1-4H3;1H/q+1;/p-1 |
| InChIKey | MDEVTFHBORSLHE-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|