C29H35N3O4S — CID 173149948
2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1-ethyl-N,N-dimethylquinolin-1-ium-6-amine;ethyl sulfate (PubChem CID 173149948) has the molecular formula C29H35N3O4S and a molecular weight of 521.68 g/mol. Its IUPAC name is 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1-ethyl-N,N-dimethylquinolin-1-ium-6-amine;ethyl sulfate.
| Compound Name | 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1-ethyl-N,N-dimethylquinolin-1-ium-6-amine;ethyl sulfate |
|---|---|
| PubChem CID | 173149948 |
| Molecular Formula | C29H35N3O4S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 2-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethenyl]-1-ethyl-N,N-dimethylquinolin-1-ium-6-amine;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[n+]1c(C=Cc2cc(C)n(-c3ccccc3)c2C)ccc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C27H30N3.C2H6O4S/c1-6-29-24(15-13-23-19-26(28(4)5)16-17-27(23)29)14-12-22-18-20(2)30(21(22)3)25-10-8-7-9-11-25;1-2-6-7(3,4)5/h7-19H,6H2,1-5H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | YFHKDSZMMCCVPX-UHFFFAOYSA-M |
| XLogP | 5.27 |
| TPSA | 78.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|