C28H38O8 — CID 91069074
[2-(2-hydroxypropoxy)-3-(2-octan-3-yloxycarbonylphenoxy)propyl] 2-hydroxybenzoate (PubChem CID 91069074) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [2-(2-hydroxypropoxy)-3-(2-octan-3-yloxycarbonylphenoxy)propyl] 2-hydroxybenzoate.
| Compound Name | [2-(2-hydroxypropoxy)-3-(2-octan-3-yloxycarbonylphenoxy)propyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 91069074 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [2-(2-hydroxypropoxy)-3-(2-octan-3-yloxycarbonylphenoxy)propyl] 2-hydroxybenzoate |
| SMILES | CCCCCC(CC)OC(=O)c1ccccc1OCC(COC(=O)c1ccccc1O)OCC(C)O |
| InChI | InChI=1S/C28H38O8/c1-4-6-7-12-21(5-2)36-28(32)24-14-9-11-16-26(24)34-18-22(33-17-20(3)29)19-35-27(31)23-13-8-10-15-25(23)30/h8-11,13-16,20-22,29-30H,4-7,12,17-19H2,1-3H3 |
| InChIKey | GRUIWNQKXMZWDQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|