C18H22FN — CID 91071303
(2E)-2-[1-(4-fluorophenyl)ethenyl]-3-propylhepta-2,4-dien-1-imine (PubChem CID 91071303) has the molecular formula C18H22FN and a molecular weight of 271.38 g/mol. Its IUPAC name is (2E)-2-[1-(4-fluorophenyl)ethenyl]-3-propylhepta-2,4-dien-1-imine.
| Compound Name | (2E)-2-[1-(4-fluorophenyl)ethenyl]-3-propylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 91071303 |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2E)-2-[1-(4-fluorophenyl)ethenyl]-3-propylhepta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(C(=C)c1ccc(F)cc1)=C(/C=CCC)CCC |
| InChI | InChI=1S/C18H22FN/c1-4-6-8-16(7-5-2)18(13-20)14(3)15-9-11-17(19)12-10-15/h6,8-13,20H,3-5,7H2,1-2H3/b8-6?,18-16-,20-13+ |
| InChIKey | PZDNFSCMIJHRCL-DFPUOFSXSA-N |
| XLogP | 5.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|