C32H35N5O2S — CID 91073185
N-butyl-5-[[1-[(4-cyanophenyl)methyl]imidazol-2-yl]methyl-(cyclohexanecarbonyl)amino]-1-benzothiophene-2-carboxamide (PubChem CID 91073185) has the molecular formula C32H35N5O2S and a molecular weight of 553.73 g/mol. Its IUPAC name is N-butyl-5-[[1-[(4-cyanophenyl)methyl]imidazol-2-yl]methyl-(cyclohexanecarbonyl)amino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-butyl-5-[[1-[(4-cyanophenyl)methyl]imidazol-2-yl]methyl-(cyclohexanecarbonyl)amino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91073185 |
| Molecular Formula | C32H35N5O2S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | N-butyl-5-[[1-[(4-cyanophenyl)methyl]imidazol-2-yl]methyl-(cyclohexanecarbonyl)amino]-1-benzothiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc2cc(N(Cc3nccn3Cc3ccc(C#N)cc3)C(=O)C3CCCCC3)ccc2s1 |
| InChI | InChI=1S/C32H35N5O2S/c1-2-3-15-35-31(38)29-19-26-18-27(13-14-28(26)40-29)37(32(39)25-7-5-4-6-8-25)22-30-34-16-17-36(30)21-24-11-9-23(20-33)10-12-24/h9-14,16-19,25H,2-8,15,21-22H2,1H3,(H,35,38) |
| InChIKey | BSZONDTYXSKQPB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|