C11H15NO6 — CID 91073701
4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylhexanoic acid (PubChem CID 91073701) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylhexanoic acid.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylhexanoic acid |
|---|---|
| PubChem CID | 91073701 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)oxycarbonylhexanoic acid |
| SMILES | CCC(CCC(=O)O)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H15NO6/c1-2-7(3-6-10(15)16)11(17)18-12-8(13)4-5-9(12)14/h4-5,7,13-14H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | WENMNSLUVIDRGK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |