C41H39BN2O2 — CID 91074003
3-[3-[3-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine (PubChem CID 91074003) has the molecular formula C41H39BN2O2 and a molecular weight of 602.59 g/mol. Its IUPAC name is 3-[3-[3-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine.
| Compound Name | 3-[3-[3-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 91074003 |
| Molecular Formula | C41H39BN2O2 |
| Molecular Weight | 602.59 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 3-[3-[3-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
| SMILES | CC1C(B2OC(C)(C)C(C)(C)O2)=CC=CC1c1cc(-c2cccc(-c3cccnc3)c2)cc(-c2cccc(-c3cccnc3)c2)c1 |
| InChI | InChI=1S/C41H39BN2O2/c1-28-38(17-8-18-39(28)42-45-40(2,3)41(4,5)46-42)37-24-35(31-13-6-11-29(21-31)33-15-9-19-43-26-33)23-36(25-37)32-14-7-12-30(22-32)34-16-10-20-44-27-34/h6-28,38H,1-5H3 |
| InChIKey | HNXQBUMUJPEGAY-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.59 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|