C13H17N3 — CID 910757
3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine (PubChem CID 910757) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine.
| Compound Name | 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine |
|---|---|
| PubChem CID | 910757 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine |
| SMILES | CCc1c(N(C)C)nc2ccccc2c1N |
| InChI | InChI=1S/C13H17N3/c1-4-9-12(14)10-7-5-6-8-11(10)15-13(9)16(2)3/h5-8H,4H2,1-3H3,(H2,14,15) |
| InChIKey | QFVQHSUSSINTLS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |