About 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine
3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine (PubChem CID 910757) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine.
Molecular Properties
| Compound Name | 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine |
| PubChem CID | 910757 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine |
| SMILES | CCc1c(N(C)C)nc2ccccc2c1N |
| InChI | InChI=1S/C13H17N3/c1-4-9-12(14)10-7-5-6-8-11(10)15-13(9)16(2)3/h5-8H,4H2,1-3H3,(H2,14,15) |
| InChIKey | QFVQHSUSSINTLS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine?
The IUPAC name of 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine (CID 910757) is 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine.
What is the SMILES notation for 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine?
The canonical SMILES for 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine is CCc1c(N(C)C)nc2ccccc2c1N.
What is the InChIKey of 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine?
The InChIKey is QFVQHSUSSINTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-4-9-12(14)10-7-5-6-8-11(10)15-13(9)16(2)3/h5-8H,4H2,1-3H3,(H2,14,15).
What are the key properties of 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine?
3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine has a molecular weight of 215.30 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-N,2-N-dimethylquinoline-2,4-diamine is sourced from PubChem (CID 910757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).