C21H18F3NO4 — CID 91075873
butyl 7-[3-(trifluoromethoxy)phenoxy]isoquinoline-3-carboxylate (PubChem CID 91075873) has the molecular formula C21H18F3NO4 and a molecular weight of 405.37 g/mol. Its IUPAC name is butyl 7-[3-(trifluoromethoxy)phenoxy]isoquinoline-3-carboxylate.
| Compound Name | butyl 7-[3-(trifluoromethoxy)phenoxy]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 91075873 |
| Molecular Formula | C21H18F3NO4 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | butyl 7-[3-(trifluoromethoxy)phenoxy]isoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc2ccc(Oc3cccc(OC(F)(F)F)c3)cc2cn1 |
| InChI | InChI=1S/C21H18F3NO4/c1-2-3-9-27-20(26)19-11-14-7-8-17(10-15(14)13-25-19)28-16-5-4-6-18(12-16)29-21(22,23)24/h4-8,10-13H,2-3,9H2,1H3 |
| InChIKey | XKVBBWFEUKVKMX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|