C13H12Cl2N2O3S2 — CID 9107639
4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-sulfamoylbenzamide (PubChem CID 9107639) has the molecular formula C13H12Cl2N2O3S2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9107639 |
| Molecular Formula | C13H12Cl2N2O3S2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-sulfamoylbenzamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H12Cl2N2O3S2/c1-17(7-9-3-5-12(15)21-9)13(18)8-2-4-10(14)11(6-8)22(16,19)20/h2-6H,7H2,1H3,(H2,16,19,20) |
| InChIKey | BVTRTORFHVEZRG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |