C18H21ClN2O5S2 — CID 17433061
N-[(5-chlorothiophen-2-yl)methyl]-4-methoxy-N-methyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 17433061) has the molecular formula C18H21ClN2O5S2 and a molecular weight of 444.96 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-methoxy-N-methyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-methoxy-N-methyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 17433061 |
| Molecular Formula | C18H21ClN2O5S2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-methoxy-N-methyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H21ClN2O5S2/c1-20(12-14-4-6-17(19)27-14)18(22)13-3-5-15(25-2)16(11-13)28(23,24)21-7-9-26-10-8-21/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | MLLQTUJWPQYWNV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |