C26H32N2O8 — CID 91076629
(2R,4R,4aS,5R,5aS,6R,11aS,12aR)-7-cyano-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91076629) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-7-cyano-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-7-cyano-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91076629 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-7-cyano-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(O)ccc(C#N)c4[C@@H](C)[C@]3(C)[C@@H](O)[C@]12C |
| InChI | InChI=1S/C26H32N2O8/c1-9(2)16-19(31)15(22(28)34)20(32)26(36)21(33)17-18(30)14-12(29)7-6-11(8-27)13(14)10(3)24(17,4)23(35)25(16,26)5/h6-7,9-10,15-17,19,21,23,29,31,33,35-36H,1-5H3,(H2,28,34)/t10-,15-,16+,17-,19?,21?,23-,24+,25+,26+/m1/s1 |
| InChIKey | VFVDYDYXUAXMQA-FQHRXHEUSA-N |
| XLogP | -0.02 |
| TPSA | 202.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|