C26H33NO10 — CID 163820955
(5R,5aS,6R,6aS,7R,10aR)-9-carbamoyl-1,6,8,10a,11-pentahydroxy-5,5a,6a-trimethyl-10,12-dioxo-7-propan-2-yl-6,7,8,9,11,11a-hexahydro-5H-tetracene-2-carboxylic acid (PubChem CID 163820955) has the molecular formula C26H33NO10 and a molecular weight of 519.55 g/mol. Its IUPAC name is (5R,5aS,6R,6aS,7R,10aR)-9-carbamoyl-1,6,8,10a,11-pentahydroxy-5,5a,6a-trimethyl-10,12-dioxo-7-propan-2-yl-6,7,8,9,11,11a-hexahydro-5H-tetracene-2-carboxylic acid.
| Compound Name | (5R,5aS,6R,6aS,7R,10aR)-9-carbamoyl-1,6,8,10a,11-pentahydroxy-5,5a,6a-trimethyl-10,12-dioxo-7-propan-2-yl-6,7,8,9,11,11a-hexahydro-5H-tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 163820955 |
| Molecular Formula | C26H33NO10 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (5R,5aS,6R,6aS,7R,10aR)-9-carbamoyl-1,6,8,10a,11-pentahydroxy-5,5a,6a-trimethyl-10,12-dioxo-7-propan-2-yl-6,7,8,9,11,11a-hexahydro-5H-tetracene-2-carboxylic acid |
| SMILES | CC(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(O)C3C(=O)c4c(ccc(C(=O)O)c4O)[C@@H](C)[C@]3(C)[C@@H](O)[C@]12C |
| InChI | InChI=1S/C26H33NO10/c1-8(2)14-18(30)13(21(27)33)19(31)26(37)20(32)15-17(29)12-10(6-7-11(16(12)28)22(34)35)9(3)24(15,4)23(36)25(14,26)5/h6-9,13-15,18,20,23,28,30,32,36-37H,1-5H3,(H2,27,33)(H,34,35)/t9-,13?,14+,15?,18?,20?,23-,24+,25+,26+/m1/s1 |
| InChIKey | NVJFXECUPIZNKK-QKQDMALYSA-N |
| XLogP | -0.20 |
| TPSA | 215.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|