C29H35NO8S — CID 91443815
(2R,4R,4aS,5R,5aS,6R,11aS,12aR)-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-9-thiophen-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91443815) has the molecular formula C29H35NO8S and a molecular weight of 557.67 g/mol. Its IUPAC name is (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-9-thiophen-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-9-thiophen-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91443815 |
| Molecular Formula | C29H35NO8S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-9-thiophen-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(ccc(-c5cccs5)c4O)[C@@H](C)[C@]3(C)[C@@H](O)[C@]12C |
| InChI | InChI=1S/C29H35NO8S/c1-11(2)18-22(33)17(25(30)36)23(34)29(38)24(35)19-21(32)16-13(12(3)27(19,4)26(37)28(18,29)5)8-9-14(20(16)31)15-7-6-10-39-15/h6-12,17-19,22,24,26,31,33,35,37-38H,1-5H3,(H2,30,36)/t12-,17-,18+,19-,22?,24?,26-,27+,28+,29+/m1/s1 |
| InChIKey | UYWQAMDUWPKVOF-CQALNZBSSA-N |
| XLogP | 1.83 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|