C25H32FNO8 — CID 91264144
(2R,4R,4aS,5R,5aS,6R,11aS,12aR)-9-fluoro-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 91264144) has the molecular formula C25H32FNO8 and a molecular weight of 493.53 g/mol. Its IUPAC name is (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-9-fluoro-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-9-fluoro-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91264144 |
| Molecular Formula | C25H32FNO8 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2R,4R,4aS,5R,5aS,6R,11aS,12aR)-9-fluoro-3,5,10,12,12a-pentahydroxy-4a,5a,6-trimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(ccc(F)c4O)[C@@H](C)[C@]3(C)[C@@H](O)[C@]12C |
| InChI | InChI=1S/C25H32FNO8/c1-8(2)14-18(30)13(21(27)33)19(31)25(35)20(32)15-17(29)12-10(6-7-11(26)16(12)28)9(3)23(15,4)22(34)24(14,25)5/h6-9,13-15,18,20,22,28,30,32,34-35H,1-5H3,(H2,27,33)/t9-,13-,14+,15-,18?,20?,22-,23+,24+,25+/m1/s1 |
| InChIKey | MUQHZHQOBZHCKH-YOIKFWDRSA-N |
| XLogP | 0.24 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|