C31H44F2N4O4 — CID 91077704
N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(methoxyamino)-N,N-dipropylpent-2-enediamide (PubChem CID 91077704) has the molecular formula C31H44F2N4O4 and a molecular weight of 574.71 g/mol. Its IUPAC name is N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(methoxyamino)-N,N-dipropylpent-2-enediamide.
| Compound Name | N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(methoxyamino)-N,N-dipropylpent-2-enediamide |
|---|---|
| PubChem CID | 91077704 |
| Molecular Formula | C31H44F2N4O4 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | N'-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(methoxyamino)-N,N-dipropylpent-2-enediamide |
| SMILES | CCCN(CCC)C(=O)C(=CCC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cccc(CC)c1)NOC |
| InChI | InChI=1S/C31H44F2N4O4/c1-5-13-37(14-6-2)31(40)27(36-41-4)11-12-30(39)35-28(18-24-16-25(32)19-26(33)17-24)29(38)21-34-20-23-10-8-9-22(7-3)15-23/h8-11,15-17,19,28-29,34,36,38H,5-7,12-14,18,20-21H2,1-4H3,(H,35,39)/t28-,29+/m0/s1 |
| InChIKey | GSKMDRHSOFVLJN-URLMMPGGSA-N |
| XLogP | 3.78 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|