C19H18FNO4 — CID 91078792
1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]pyrrole-2,5-diol (PubChem CID 91078792) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]pyrrole-2,5-diol.
| Compound Name | 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91078792 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]pyrrole-2,5-diol |
| SMILES | CCc1ccc(Oc2ccc(-n3c(O)ccc3O)cc2F)c(OC)c1 |
| InChI | InChI=1S/C19H18FNO4/c1-3-12-4-6-16(17(10-12)24-2)25-15-7-5-13(11-14(15)20)21-18(22)8-9-19(21)23/h4-11,22-23H,3H2,1-2H3 |
| InChIKey | MFKPQMXDNBIJMF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |