4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate

C14H19NO6 — CID 91079459

IUPAC4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate
SMILESCOc1cccc(C=CC(O)OCCCCO[N+](=O)[O-])c1
InChIInChI=1S/C14H19NO6/c1-19-13-6-4-5-12(11-13)7-8-14(16)20-9-2-3-10-21-15(17)18/h4-8,11,14,16H,2-3,9-10H2,1H3
InChIKeyMHODWGYUGAQXKU-UHFFFAOYSA-N
MW297.31 g/mol
LogP2.03
Rot. Bonds10

About 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate

4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate (PubChem CID 91079459) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate.

Molecular Properties

Compound Name4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate
PubChem CID91079459
Molecular FormulaC14H19NO6
Molecular Weight297.31 g/mol
Exact Mass297.12
IUPAC Name4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate
SMILESCOc1cccc(C=CC(O)OCCCCO[N+](=O)[O-])c1
InChIInChI=1S/C14H19NO6/c1-19-13-6-4-5-12(11-13)7-8-14(16)20-9-2-3-10-21-15(17)18/h4-8,11,14,16H,2-3,9-10H2,1H3
InChIKeyMHODWGYUGAQXKU-UHFFFAOYSA-N
XLogP2.03
TPSA91.06 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.31
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate?
The IUPAC name of 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate (CID 91079459) is 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate.
What is the SMILES notation for 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate?
The canonical SMILES for 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate is COc1cccc(C=CC(O)OCCCCO[N+](=O)[O-])c1.
What is the InChIKey of 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate?
The InChIKey is MHODWGYUGAQXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO6/c1-19-13-6-4-5-12(11-13)7-8-14(16)20-9-2-3-10-21-15(17)18/h4-8,11,14,16H,2-3,9-10H2,1H3.
What are the key properties of 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate?
4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate has a molecular weight of 297.31 g/mol, XLogP of 2.03, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-hydroxy-3-(3-methoxyphenyl)prop-2-enoxy]butyl nitrate is sourced from PubChem (CID 91079459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).