C28H29ClF2N2O — CID 91080179
1-[4,4-bis(4-fluorophenyl)butyl]-N-[(4-chlorophenyl)methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 91080179) has the molecular formula C28H29ClF2N2O and a molecular weight of 483.00 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-N-[(4-chlorophenyl)methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-N-[(4-chlorophenyl)methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 91080179 |
| Molecular Formula | C28H29ClF2N2O |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-N-[(4-chlorophenyl)methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | Fc1ccc(C(CCCN2CC=C(NOCc3ccc(Cl)cc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H29ClF2N2O/c29-24-9-3-21(4-10-24)20-34-32-27-15-18-33(19-16-27)17-1-2-28(22-5-11-25(30)12-6-22)23-7-13-26(31)14-8-23/h3-15,28,32H,1-2,16-20H2 |
| InChIKey | LNDDBDOPTNNIOV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|