C29H29F5N2O — CID 90858910
1-[4,4-bis(4-fluorophenyl)butyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 90858910) has the molecular formula C29H29F5N2O and a molecular weight of 516.55 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 90858910 |
| Molecular Formula | C29H29F5N2O |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-N-[[3-(trifluoromethyl)phenyl]methoxy]-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | Fc1ccc(C(CCCN2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H29F5N2O/c30-25-10-6-22(7-11-25)28(23-8-12-26(31)13-9-23)5-2-16-36-17-14-27(15-18-36)35-37-20-21-3-1-4-24(19-21)29(32,33)34/h1,3-4,6-14,19,28,35H,2,5,15-18,20H2 |
| InChIKey | KVPIFDZURLBGQL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|