C29H26F3N3O2 — CID 90712028
5-[[[1-[4,4-bis(4-fluorophenyl)butanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile (PubChem CID 90712028) has the molecular formula C29H26F3N3O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is 5-[[[1-[4,4-bis(4-fluorophenyl)butanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[[1-[4,4-bis(4-fluorophenyl)butanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 90712028 |
| Molecular Formula | C29H26F3N3O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 5-[[[1-[4,4-bis(4-fluorophenyl)butanoyl]-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CONC2=CCN(C(=O)CCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C29H26F3N3O2/c30-24-6-2-21(3-7-24)27(22-4-8-25(31)9-5-22)10-12-29(36)35-15-13-26(14-16-35)34-37-19-20-1-11-28(32)23(17-20)18-33/h1-9,11,13,17,27,34H,10,12,14-16,19H2 |
| InChIKey | RAGPKZRLTJCEGG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|