C27H23F3N4O2 — CID 91279073
N-[bis(4-fluorophenyl)methyl]-4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 91279073) has the molecular formula C27H23F3N4O2 and a molecular weight of 492.50 g/mol. Its IUPAC name is N-[bis(4-fluorophenyl)methyl]-4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[bis(4-fluorophenyl)methyl]-4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 91279073 |
| Molecular Formula | C27H23F3N4O2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[bis(4-fluorophenyl)methyl]-4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | N#Cc1cc(CONC2=CCN(C(=O)NC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C27H23F3N4O2/c28-22-6-2-19(3-7-22)26(20-4-8-23(29)9-5-20)32-27(35)34-13-11-24(12-14-34)33-36-17-18-1-10-25(30)21(15-18)16-31/h1-11,15,26,33H,12-14,17H2,(H,32,35) |
| InChIKey | VSGFINUIEVFTFJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|