C29H25F8N3O2 — CID 91148577
2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 91148577) has the molecular formula C29H25F8N3O2 and a molecular weight of 599.52 g/mol. Its IUPAC name is 2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 91148577 |
| Molecular Formula | C29H25F8N3O2 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CN1CC=C(NOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H25F8N3O2/c30-23-5-1-19(2-6-23)27(20-3-7-24(31)8-4-20)42-39-25-9-11-40(12-10-25)17-26(41)38-16-18-13-21(28(32,33)34)15-22(14-18)29(35,36)37/h1-9,13-15,27,39H,10-12,16-17H2,(H,38,41) |
| InChIKey | TZGZDVAOOJJNLL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|