C28H23F8N3O2 — CID 90867765
2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 90867765) has the molecular formula C28H23F8N3O2 and a molecular weight of 585.50 g/mol. Its IUPAC name is 2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 90867765 |
| Molecular Formula | C28H23F8N3O2 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-[4-[bis(4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CC=C(NOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H23F8N3O2/c29-21-5-1-17(2-6-21)26(18-3-7-22(30)8-4-18)41-38-23-9-11-39(12-10-23)16-25(40)37-24-14-19(27(31,32)33)13-20(15-24)28(34,35)36/h1-9,13-15,26,38H,10-12,16H2,(H,37,40) |
| InChIKey | PAFQHGRBRPNCQD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|