C20H19F4N3O4S — CID 123414938
N-(4-fluorophenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide (PubChem CID 123414938) has the molecular formula C20H19F4N3O4S and a molecular weight of 473.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide |
|---|---|
| PubChem CID | 123414938 |
| Molecular Formula | C20H19F4N3O4S |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide |
| SMILES | O=C(CONC1=CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F4N3O4S/c21-15-4-6-16(7-5-15)25-19(28)13-31-26-17-8-10-27(11-9-17)32(29,30)18-3-1-2-14(12-18)20(22,23)24/h1-8,12,26H,9-11,13H2,(H,25,28) |
| InChIKey | WLJSOLUPSOVJOV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|