C21H24F3N3O4S — CID 91380108
2-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]anilino]ethanol (PubChem CID 91380108) has the molecular formula C21H24F3N3O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 2-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]anilino]ethanol.
| Compound Name | 2-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]anilino]ethanol |
|---|---|
| PubChem CID | 91380108 |
| Molecular Formula | C21H24F3N3O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]anilino]ethanol |
| SMILES | O=S(=O)(c1ccc(NCCO)cc1)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H24F3N3O4S/c22-21(23,24)17-3-1-2-16(14-17)15-31-26-19-8-11-27(12-9-19)32(29,30)20-6-4-18(5-7-20)25-10-13-28/h1-8,14,25-26,28H,9-13,15H2 |
| InChIKey | LTKIVAFLZZPCMC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|