C19H24F3N3O5S — CID 123933997
1-piperidin-1-yl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethanone (PubChem CID 123933997) has the molecular formula C19H24F3N3O5S and a molecular weight of 463.48 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethanone.
| Compound Name | 1-piperidin-1-yl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethanone |
|---|---|
| PubChem CID | 123933997 |
| Molecular Formula | C19H24F3N3O5S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-piperidin-1-yl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyethanone |
| SMILES | O=C(CONC1=CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C19H24F3N3O5S/c20-19(21,22)30-16-4-6-17(7-5-16)31(27,28)25-12-8-15(9-13-25)23-29-14-18(26)24-10-2-1-3-11-24/h4-8,23H,1-3,9-14H2 |
| InChIKey | PLRBFLJCDXCBDF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|