C19H20F3N3O5S — CID 90921266
1-methyl-3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]pyridin-2-one (PubChem CID 90921266) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is 1-methyl-3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]pyridin-2-one.
| Compound Name | 1-methyl-3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]pyridin-2-one |
|---|---|
| PubChem CID | 90921266 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 1-methyl-3-[[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxymethyl]pyridin-2-one |
| SMILES | Cn1cccc(CONC2=CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)c1=O |
| InChI | InChI=1S/C19H20F3N3O5S/c1-24-10-2-3-14(18(24)26)13-29-23-15-8-11-25(12-9-15)31(27,28)17-6-4-16(5-7-17)30-19(20,21)22/h2-8,10,23H,9,11-13H2,1H3 |
| InChIKey | XYWQNBIDAPTKPW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|