C21H23F3N4O3S — CID 91176266
N-cyclopropyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine (PubChem CID 91176266) has the molecular formula C21H23F3N4O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is N-cyclopropyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine.
| Compound Name | N-cyclopropyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 91176266 |
| Molecular Formula | C21H23F3N4O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-cyclopropyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NC2CC2)nc1)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H23F3N4O3S/c22-21(23,24)16-3-1-2-15(12-16)14-31-27-18-8-10-28(11-9-18)32(29,30)19-6-7-20(25-13-19)26-17-4-5-17/h1-3,6-8,12-13,17,27H,4-5,9-11,14H2,(H,25,26) |
| InChIKey | ACIHZQOBOLNPRU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|