C20H23F3N4O3S — CID 91209095
N,N-dimethyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine (PubChem CID 91209095) has the molecular formula C20H23F3N4O3S and a molecular weight of 456.49 g/mol. Its IUPAC name is N,N-dimethyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine.
| Compound Name | N,N-dimethyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 91209095 |
| Molecular Formula | C20H23F3N4O3S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N,N-dimethyl-5-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pyridin-2-amine |
| SMILES | CN(C)c1ccc(S(=O)(=O)N2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)cn1 |
| InChI | InChI=1S/C20H23F3N4O3S/c1-26(2)19-7-6-18(13-24-19)31(28,29)27-10-8-17(9-11-27)25-30-14-15-4-3-5-16(12-15)20(21,22)23/h3-8,12-13,25H,9-11,14H2,1-2H3 |
| InChIKey | ITFYMBKMACBASF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|