C21H22F3N3O5S — CID 91334404
N-(3-methoxyphenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide (PubChem CID 91334404) has the molecular formula C21H22F3N3O5S and a molecular weight of 485.48 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide |
|---|---|
| PubChem CID | 91334404 |
| Molecular Formula | C21H22F3N3O5S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[[1-[3-(trifluoromethyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide |
| SMILES | COc1cccc(NC(=O)CONC2=CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C21H22F3N3O5S/c1-31-18-6-3-5-17(13-18)25-20(28)14-32-26-16-8-10-27(11-9-16)33(29,30)19-7-2-4-15(12-19)21(22,23)24/h2-8,12-13,26H,9-11,14H2,1H3,(H,25,28) |
| InChIKey | XLEXXWXIKHQJIG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|