C20H19F4N3O5S — CID 90980833
N-(4-fluorophenyl)-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide (PubChem CID 90980833) has the molecular formula C20H19F4N3O5S and a molecular weight of 489.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide |
|---|---|
| PubChem CID | 90980833 |
| Molecular Formula | C20H19F4N3O5S |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonyl-3,6-dihydro-2H-pyridin-4-yl]amino]oxyacetamide |
| SMILES | O=C(CONC1=CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F4N3O5S/c21-14-1-3-15(4-2-14)25-19(28)13-31-26-16-9-11-27(12-10-16)33(29,30)18-7-5-17(6-8-18)32-20(22,23)24/h1-9,26H,10-13H2,(H,25,28) |
| InChIKey | UYXXYQIURVWFGS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|