C21H21FN4O4S — CID 90726764
N-[4-[[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide (PubChem CID 90726764) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[4-[[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90726764 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[4-[[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC=C(NOCc3ccc(F)c(C#N)c3)CC2)cc1 |
| InChI | InChI=1S/C21H21FN4O4S/c1-15(27)24-18-3-5-20(6-4-18)31(28,29)26-10-8-19(9-11-26)25-30-14-16-2-7-21(22)17(12-16)13-23/h2-8,12,25H,9-11,14H2,1H3,(H,24,27) |
| InChIKey | LXYZWNPWDVDWJG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|