C18H24F3N3O5S — CID 58378610
N,N-diethyl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide (PubChem CID 58378610) has the molecular formula C18H24F3N3O5S and a molecular weight of 451.47 g/mol. Its IUPAC name is N,N-diethyl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide.
| Compound Name | N,N-diethyl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 58378610 |
| Molecular Formula | C18H24F3N3O5S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N,N-diethyl-2-[[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]amino]oxyacetamide |
| SMILES | CCN(CC)C(=O)CON=C1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H24F3N3O5S/c1-3-23(4-2)17(25)13-28-22-14-9-11-24(12-10-14)30(26,27)16-7-5-15(6-8-16)29-18(19,20)21/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | LQHWARVZGMQBNU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|